ChemNet > CAS > 83594-38-1 (2E)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoate
83594-38-1 (2E)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoate
| product Name |
(2E)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoate |
| CAS No |
83594-38-1 |
| Synonyms |
2-(2-Formamidothiazole-4-yl)-2-methoxyimino acetic acid; 2-(2-Formylamino-1,3-thiazol-4-yl)-2-(methoxyimino)acetic acid; 2-(Formylamino)-alpha-methoxyimino-4-thiazoleacetic acid; (2E)-[2-(formylamino)-1,3-thiazol-4-yl](methoxyimino)ethanoic acid |
| Molecular Formula |
C7H6N3O4S |
| Molecular Weight |
228.2058 |
| InChI |
InChI=1/C7H7N3O4S/c1-14-10-5(6(12)13)4-2-15-7(9-4)8-3-11/h2-3H,1H3,(H,12,13)(H,8,9,11)/p-1/b10-5+ |
| Molecular Structure |
ethanoate](https://images-a.chemnet.com/suppliers/chembase/340/111340_1.png)
|
| Melting point |
160-165℃ |
| Boiling point |
438.5°C at 760 mmHg |
| Flash point |
219°C |
| Vapour Pressur |
1.83E-08mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
